| Pharmaceutical Information |
| Drug Name |
Ethotoin |
| Drug ID |
BADD_D00847 |
| Description |
Ethotoin is a hydantoin derivative and anticonvulsant. Ethotoin exerts an antiepileptic effect without causing general central nervous system depression. The mechanism of action is probably very similar to that of phenytoin. The latter drug appears to stabilize rather than to raise the normal seizure threshold, and to prevent the spread of seizure activity rather than to abolish the primary focus of seizure discharges. Ethotoin is no longer commonly used. |
| Indications and Usage |
For the control of tonic-clonic (grand mal) and complex partial (psychomotor) seizures. |
| Marketing Status |
approved |
| ATC Code |
N03AB01 |
| DrugBank ID |
DB00754
|
| KEGG ID |
D00708
|
| MeSH ID |
C084606
|
| PubChem ID |
3292
|
| TTD Drug ID |
D05EPM
|
| NDC Product Code |
45562-1133 |
| UNII |
46QG38NC4U
|
| Synonyms |
ethotoin | Peganone |
|
| Chemical Information |
| Molecular Formula |
C11H12N2O2 |
| CAS Registry Number |
86-35-1 |
| SMILES |
CCN1C(=O)C(NC1=O)C2=CC=CC=C2 |
| Chemical Structure |
|
|
| ADRs Induced by Drug |
|
|
*The priority for ADR severity classification is based on FAERS assessment, followed by the most severe level in CTCAE rating. If neither is available, it will be displayed as 'Not available'.
**The 'Not Available' level is hidden by default and can be restored by clicking on the legend twice.
|
|
|
