| Pharmaceutical Information |
| Drug Name |
Cefotaxime sodium |
| Drug ID |
BADD_D00391 |
| Description |
Cefotaxime is a third-generation cephalosporin antibiotic. Like other third-generation cephalosporins, it has broad spectrum activity against Gram positive and Gram negative bacteria. In most cases, it is considered to be equivalent to ceftriaxone in terms of safety and efficacy. Cefotaxime sodium is marketed under various trade names including Claforan (Sanofi-Aventis). |
| Indications and Usage |
Used to treat gonorrhoea, meningitis, and severe infections including infections of the kidney (pyelonephritis) and urinary system. Also used before an operation to prevent infection after surgery. |
| Marketing Status |
approved |
| ATC Code |
J01DD01 |
| DrugBank ID |
DB00493
|
| KEGG ID |
D00919
|
| MeSH ID |
D002439
|
| PubChem ID |
10695961
|
| TTD Drug ID |
D0D1HA
|
| NDC Product Code |
52946-0826 |
| UNII |
258J72S7TZ
|
| Synonyms |
Cefotaxime | Cephotaxim | Cefotaxim | Biosint | Cefotaxime Sodium | Sodium, Cefotaxime | Cefradil | Taporin | Fotexina | HR-756 | HR 756 | HR756 | Kendrick | Ru-24756 | Ru 24756 | Ru24756 | Benaxima | Claforan | Primafen | Klaforan |
|
| Chemical Information |
| Molecular Formula |
C16H16N5NaO7S2 |
| CAS Registry Number |
63527-52-6 |
| SMILES |
CC(=O)OCC1=C(N2C(C(C2=O)NC(=O)C(=NOC)C3=CSC(=N3)N)SC1)C(=O)[O-].[Na+] |
| Chemical Structure |
|
|
| ADRs Induced by Drug |
|
|
*The priority for ADR severity classification is based on FAERS assessment, followed by the most severe level in CTCAE rating. If neither is available, it will be displayed as 'Not available'.
**The 'Not Available' level is hidden by default and can be restored by clicking on the legend twice.
|
|
|
